C12H18N4O2S2 — CID 135674018
2-(2-hydroxyethylamino)-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 135674018) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 2-(2-hydroxyethylamino)-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135674018 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(2-hydroxyethylamino)-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCCCSc1nc2nc(NCCO)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H18N4O2S2/c1-2-3-4-7-19-12-15-9-8(10(18)16-12)20-11(14-9)13-5-6-17/h17H,2-7H2,1H3,(H2,13,14,15,16,18) |
| InChIKey | TWPSMEFSRUOQEK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|