C16H10N6O4S — CID 135456334
3-nitro-N-(5-oxo-2-thiophen-2-yl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide (PubChem CID 135456334) has the molecular formula C16H10N6O4S and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-nitro-N-(5-oxo-2-thiophen-2-yl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide.
| Compound Name | 3-nitro-N-(5-oxo-2-thiophen-2-yl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide |
|---|---|
| PubChem CID | 135456334 |
| Molecular Formula | C16H10N6O4S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-nitro-N-(5-oxo-2-thiophen-2-yl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide |
| SMILES | O=C(Nc1cc(=O)[nH]c2nc(-c3cccs3)nn12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10N6O4S/c23-13-8-12(17-15(24)9-3-1-4-10(7-9)22(25)26)21-16(18-13)19-14(20-21)11-5-2-6-27-11/h1-8H,(H,17,24)(H,18,19,20,23) |
| InChIKey | JPAJCEFVWAJMKU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|