C27H21N3O4 — CID 135458337
3-(4-hydroxy-3-isoquinolin-1-ylanilino)-4-[[(1S)-1-(3-hydroxyphenyl)ethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 135458337) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 3-(4-hydroxy-3-isoquinolin-1-ylanilino)-4-[[(1S)-1-(3-hydroxyphenyl)ethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-hydroxy-3-isoquinolin-1-ylanilino)-4-[[(1S)-1-(3-hydroxyphenyl)ethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 135458337 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-(4-hydroxy-3-isoquinolin-1-ylanilino)-4-[[(1S)-1-(3-hydroxyphenyl)ethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@H](Nc1c(Nc2ccc(O)c(-c3nccc4ccccc34)c2)c(=O)c1=O)c1cccc(O)c1 |
| InChI | InChI=1S/C27H21N3O4/c1-15(17-6-4-7-19(31)13-17)29-24-25(27(34)26(24)33)30-18-9-10-22(32)21(14-18)23-20-8-3-2-5-16(20)11-12-28-23/h2-15,29-32H,1H3/t15-/m0/s1 |
| InChIKey | RKAATTGOLRWKTB-HNNXBMFYSA-N |
| XLogP | 4.83 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|