C24H21N3O3 — CID 87659261
3-[[2-[4-(hydroxymethyl)phenyl]-4-pyridinyl]amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 87659261) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[[2-[4-(hydroxymethyl)phenyl]-4-pyridinyl]amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[2-[4-(hydroxymethyl)phenyl]-4-pyridinyl]amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87659261 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[[2-[4-(hydroxymethyl)phenyl]-4-pyridinyl]amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(Nc2ccnc(-c3ccc(CO)cc3)c2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O3/c1-15(17-5-3-2-4-6-17)26-21-22(24(30)23(21)29)27-19-11-12-25-20(13-19)18-9-7-16(14-28)8-10-18/h2-13,15,26,28H,14H2,1H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | AYAMOXBMWQMUGN-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|