C21H22N4O3 — CID 25207518
3-[(2-morpholin-4-yl-4-pyridinyl)amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 25207518) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[(2-morpholin-4-yl-4-pyridinyl)amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-morpholin-4-yl-4-pyridinyl)amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 25207518 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[(2-morpholin-4-yl-4-pyridinyl)amino]-4-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(Nc2ccnc(N3CCOCC3)c2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O3/c1-14(15-5-3-2-4-6-15)23-18-19(21(27)20(18)26)24-16-7-8-22-17(13-16)25-9-11-28-12-10-25/h2-8,13-14,23H,9-12H2,1H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | XPEOERXLLIODOB-CQSZACIVSA-N |
| XLogP | 2.43 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|