C18H23N3O3S — CID 135463404
5-[N-(2-ethoxyphenyl)-C-methylcarbonimidoyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135463404) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-[N-(2-ethoxyphenyl)-C-methylcarbonimidoyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[N-(2-ethoxyphenyl)-C-methylcarbonimidoyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135463404 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[N-(2-ethoxyphenyl)-C-methylcarbonimidoyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCOc1ccccc1/N=C(\C)c1c(O)n(CC)c(=S)n(CC)c1=O |
| InChI | InChI=1S/C18H23N3O3S/c1-5-20-16(22)15(17(23)21(6-2)18(20)25)12(4)19-13-10-8-9-11-14(13)24-7-3/h8-11,22H,5-7H2,1-4H3/b19-12+ |
| InChIKey | DHPDLLGGPRBSIH-XDHOZWIPSA-N |
| XLogP | 3.66 |
| TPSA | 68.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|