C22H23N3O5 — CID 1491927
1-(2-ethoxyphenyl)-6-hydroxy-5-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]pyrimidine-2,4-dione (PubChem CID 1491927) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-6-hydroxy-5-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-ethoxyphenyl)-6-hydroxy-5-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1491927 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-(2-ethoxyphenyl)-6-hydroxy-5-[N-[(2-methoxyphenyl)methyl]-C-methylcarbonimidoyl]pyrimidine-2,4-dione |
| SMILES | CCOc1ccccc1-n1c(O)c(/C(C)=N/Cc2ccccc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H23N3O5/c1-4-30-18-12-8-6-10-16(18)25-21(27)19(20(26)24-22(25)28)14(2)23-13-15-9-5-7-11-17(15)29-3/h5-12,27H,4,13H2,1-3H3,(H,24,26,28)/b23-14+ |
| InChIKey | WYMNBXTUGXRGKD-OEAKJJBVSA-N |
| XLogP | 2.65 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|