C16H13N3O2 — CID 135463984
5-benzoyl-2,7,8,9-tetrahydropyrimido[5,4-a]pyrrolizin-1-one (PubChem CID 135463984) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-benzoyl-2,7,8,9-tetrahydropyrimido[5,4-a]pyrrolizin-1-one.
| Compound Name | 5-benzoyl-2,7,8,9-tetrahydropyrimido[5,4-a]pyrrolizin-1-one |
|---|---|
| PubChem CID | 135463984 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-benzoyl-2,7,8,9-tetrahydropyrimido[5,4-a]pyrrolizin-1-one |
| SMILES | O=C(c1ccccc1)c1c2nc[nH]c(=O)c2c2n1CCC2 |
| InChI | InChI=1S/C16H13N3O2/c20-15(10-5-2-1-3-6-10)14-13-12(16(21)18-9-17-13)11-7-4-8-19(11)14/h1-3,5-6,9H,4,7-8H2,(H,17,18,21) |
| InChIKey | ZWBYDLOAEFFZJQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |