C22H15N5O2 — CID 135464441
4-amino-6-naphthalen-1-yl-3-phenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione (PubChem CID 135464441) has the molecular formula C22H15N5O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-amino-6-naphthalen-1-yl-3-phenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione.
| Compound Name | 4-amino-6-naphthalen-1-yl-3-phenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione |
|---|---|
| PubChem CID | 135464441 |
| Molecular Formula | C22H15N5O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-amino-6-naphthalen-1-yl-3-phenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione |
| SMILES | Nc1c2nc(-c3cccc4ccccc34)[nH]c(=O)c2nc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H15N5O2/c23-19-17-18(25-22(29)27(19)14-9-2-1-3-10-14)21(28)26-20(24-17)16-12-6-8-13-7-4-5-11-15(13)16/h1-12H,23H2,(H,24,26,28) |
| InChIKey | KBBBFAIRFGKMTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |