C17H10ClN3OS2 — CID 135439745
5-(2-chlorophenyl)-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 135439745) has the molecular formula C17H10ClN3OS2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-(2-chlorophenyl)-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135439745 |
| Molecular Formula | C17H10ClN3OS2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 5-(2-chlorophenyl)-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c(-c2ccccc2Cl)nc2c1sc(=S)n2-c1ccccc1 |
| InChI | InChI=1S/C17H10ClN3OS2/c18-12-9-5-4-8-11(12)14-19-15-13(16(22)20-14)24-17(23)21(15)10-6-2-1-3-7-10/h1-9H,(H,19,20,22) |
| InChIKey | OOLVEVCOXUJXKF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|