C17H11ClN4S2 — CID 155810499
7-amino-5-(4-chlorophenyl)-3-phenyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (PubChem CID 155810499) has the molecular formula C17H11ClN4S2 and a molecular weight of 370.89 g/mol. Its IUPAC name is 7-amino-5-(4-chlorophenyl)-3-phenyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
| Compound Name | 7-amino-5-(4-chlorophenyl)-3-phenyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 155810499 |
| Molecular Formula | C17H11ClN4S2 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 7-amino-5-(4-chlorophenyl)-3-phenyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| SMILES | Nc1nc(-c2ccc(Cl)cc2)nc2c1sc(=S)n2-c1ccccc1 |
| InChI | InChI=1S/C17H11ClN4S2/c18-11-8-6-10(7-9-11)15-20-14(19)13-16(21-15)22(17(23)24-13)12-4-2-1-3-5-12/h1-9H,(H2,19,20,21) |
| InChIKey | AJTSSPAMBYGUDE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|