C20H11N5S2 — CID 10068668
2-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)propanedinitrile (PubChem CID 10068668) has the molecular formula C20H11N5S2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 2-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)propanedinitrile.
| Compound Name | 2-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)propanedinitrile |
|---|---|
| PubChem CID | 10068668 |
| Molecular Formula | C20H11N5S2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)propanedinitrile |
| SMILES | N#CC(C#N)c1nc(-c2ccccc2)nc2c1sc(=S)n2-c1ccccc1 |
| InChI | InChI=1S/C20H11N5S2/c21-11-14(12-22)16-17-19(24-18(23-16)13-7-3-1-4-8-13)25(20(26)27-17)15-9-5-2-6-10-15/h1-10,14H |
| InChIKey | ATYYNZACASSYPD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|