C19H11F3N4OS2 — CID 155805718
N-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)-2,2,2-trifluoroacetamide (PubChem CID 155805718) has the molecular formula C19H11F3N4OS2 and a molecular weight of 432.45 g/mol. Its IUPAC name is N-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 155805718 |
| Molecular Formula | C19H11F3N4OS2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | N-(3,5-diphenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)nc2c1sc(=S)n2-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H11F3N4OS2/c20-19(21,22)17(27)25-15-13-16(24-14(23-15)11-7-3-1-4-8-11)26(18(28)29-13)12-9-5-2-6-10-12/h1-10H,(H,23,24,25,27) |
| InChIKey | DMBZSFDFBSWWDK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|