C20H18F3N5OS — CID 141146312
2,2,2-trifluoro-N-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phenyl]acetamide (PubChem CID 141146312) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 141146312 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3nc(-c4ccccc4)ns3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H18F3N5OS/c21-20(22,23)18(29)24-15-6-8-16(9-7-15)27-10-12-28(13-11-27)19-25-17(26-30-19)14-4-2-1-3-5-14/h1-9H,10-13H2,(H,24,29) |
| InChIKey | CIUDBOXFWPTTHO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|