About 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one
2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one (PubChem CID 135465412) has the molecular formula C19H16Cl2N2OS
and a molecular weight of 391.32 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one |
| PubChem CID | 135465412 |
| Molecular Formula | C19H16Cl2N2OS |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(Cc2c(Cl)cccc2Cl)nc(SCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C19H16Cl2N2OS/c1-12-17(10-14-15(20)8-5-9-16(14)21)22-19(23-18(12)24)25-11-13-6-3-2-4-7-13/h2-9H,10-11H2,1H3,(H,22,23,24) |
| InChIKey | PFPNUVOHVYKDMJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one?
The IUPAC name of 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one (CID 135465412) is 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one is Cc1c(Cc2c(Cl)cccc2Cl)nc(SCc2ccccc2)[nH]c1=O.
What is the InChIKey of 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one?
The InChIKey is PFPNUVOHVYKDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N2OS/c1-12-17(10-14-15(20)8-5-9-16(14)21)22-19(23-18(12)24)25-11-13-6-3-2-4-7-13/h2-9H,10-11H2,1H3,(H,22,23,24).
What are the key properties of 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one?
2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one has a molecular weight of 391.32 g/mol, XLogP of 5.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135465412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).