C22H20ClFN2O2S — CID 135949031
4-[(2-chloro-6-fluorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 135949031) has the molecular formula C22H20ClFN2O2S and a molecular weight of 430.93 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135949031 |
| Molecular Formula | C22H20ClFN2O2S |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1c(Cc2c(F)cccc2Cl)nc(SCC(=O)c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C22H20ClFN2O2S/c1-13(2)20-18(11-15-16(23)9-6-10-17(15)24)25-22(26-21(20)28)29-12-19(27)14-7-4-3-5-8-14/h3-10,13H,11-12H2,1-2H3,(H,25,26,28) |
| InChIKey | QCSPVJXQGJUTIE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |