C15H11F3N2O2 — CID 135465899
4-[1-methyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol (PubChem CID 135465899) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 4-[1-methyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol.
| Compound Name | 4-[1-methyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135465899 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[1-methyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol |
| SMILES | Cn1nc(-c2ccc(O)cc2O)c2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C15H11F3N2O2/c1-20-14-10(3-2-4-11(14)15(16,17)18)13(19-20)9-6-5-8(21)7-12(9)22/h2-7,21-22H,1H3 |
| InChIKey | GRCDZFUAPCSCFH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |