C19H13FN2O3 — CID 135492495
4-[1-(3-fluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol (PubChem CID 135492495) has the molecular formula C19H13FN2O3 and a molecular weight of 336.32 g/mol. Its IUPAC name is 4-[1-(3-fluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol.
| Compound Name | 4-[1-(3-fluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135492495 |
| Molecular Formula | C19H13FN2O3 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[1-(3-fluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nn(-c3cccc(F)c3)c3cc(O)ccc23)c(O)c1 |
| InChI | InChI=1S/C19H13FN2O3/c20-11-2-1-3-12(8-11)22-17-9-13(23)4-6-15(17)19(21-22)16-7-5-14(24)10-18(16)25/h1-10,23-25H |
| InChIKey | OFIVJOJVGANQBF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |