C22H21N5O6S — CID 135466210
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate (PubChem CID 135466210) has the molecular formula C22H21N5O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 135466210 |
| Molecular Formula | C22H21N5O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H21N5O6S/c1-14(28)24-15-7-9-16(10-8-15)34(31,32)27(2)12-21(30)33-13-20(29)17(11-23)22-25-18-5-3-4-6-19(18)26-22/h3-10,29H,12-13H2,1-2H3,(H,24,28)(H,25,26)/b20-17- |
| InChIKey | UFWXKTJSQSARPM-JZJYNLBNSA-N |
| XLogP | 2.18 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|