C9H8ClN3O4S — CID 135466456
2-(3-aminothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride (PubChem CID 135466456) has the molecular formula C9H8ClN3O4S and a molecular weight of 289.70 g/mol. Its IUPAC name is 2-(3-aminothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride.
| Compound Name | 2-(3-aminothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 135466456 |
| Molecular Formula | C9H8ClN3O4S |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-(3-aminothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.Nc1ccsc1-c1nc(C(=O)O)c(O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H7N3O4S.ClH/c10-3-1-2-17-6(3)7-11-4(9(15)16)5(13)8(14)12-7;/h1-2,13H,10H2,(H,15,16)(H,11,12,14);1H |
| InChIKey | MHBSJWUSEKHLBM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |