C23H19N3O4 — CID 135468785
7-hydroxy-N-(2-methoxyphenyl)-2-(phenylhydrazinylidene)chromene-3-carboxamide (PubChem CID 135468785) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 7-hydroxy-N-(2-methoxyphenyl)-2-(phenylhydrazinylidene)chromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-(2-methoxyphenyl)-2-(phenylhydrazinylidene)chromene-3-carboxamide |
|---|---|
| PubChem CID | 135468785 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 7-hydroxy-N-(2-methoxyphenyl)-2-(phenylhydrazinylidene)chromene-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2ccc(O)cc2oc1=NNc1ccccc1 |
| InChI | InChI=1S/C23H19N3O4/c1-29-20-10-6-5-9-19(20)24-22(28)18-13-15-11-12-17(27)14-21(15)30-23(18)26-25-16-7-3-2-4-8-16/h2-14,25,27H,1H3,(H,24,28) |
| InChIKey | WAEWEWVFXJGTOA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|