C22H15Cl2N3O3 — CID 135423153
N-(2,4-dichlorophenyl)-7-hydroxy-2-(phenylhydrazinylidene)chromene-3-carboxamide (PubChem CID 135423153) has the molecular formula C22H15Cl2N3O3 and a molecular weight of 440.29 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-7-hydroxy-2-(phenylhydrazinylidene)chromene-3-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-7-hydroxy-2-(phenylhydrazinylidene)chromene-3-carboxamide |
|---|---|
| PubChem CID | 135423153 |
| Molecular Formula | C22H15Cl2N3O3 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-7-hydroxy-2-(phenylhydrazinylidene)chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc2ccc(O)cc2oc1=NNc1ccccc1 |
| InChI | InChI=1S/C22H15Cl2N3O3/c23-14-7-9-19(18(24)11-14)25-21(29)17-10-13-6-8-16(28)12-20(13)30-22(17)27-26-15-4-2-1-3-5-15/h1-12,26,28H,(H,25,29) |
| InChIKey | BDXPHUVIJSGJLK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|