C17H14N2O5 — CID 135473864
7-hydroxy-2-hydroxyimino-N-(3-methoxyphenyl)chromene-3-carboxamide (PubChem CID 135473864) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 7-hydroxy-2-hydroxyimino-N-(3-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 7-hydroxy-2-hydroxyimino-N-(3-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 135473864 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 7-hydroxy-2-hydroxyimino-N-(3-methoxyphenyl)chromene-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc3ccc(O)cc3oc2=NO)c1 |
| InChI | InChI=1S/C17H14N2O5/c1-23-13-4-2-3-11(8-13)18-16(21)14-7-10-5-6-12(20)9-15(10)24-17(14)19-22/h2-9,20,22H,1H3,(H,18,21) |
| InChIKey | HTUMPPPWHOUPQI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|