C11H11N2O3S- — CID 135468933
(1E)-N-(3-cyano-5-ethoxycarbonyl-4-methylthiophen-2-yl)ethanimidate (PubChem CID 135468933) has the molecular formula C11H11N2O3S- and a molecular weight of 251.29 g/mol. Its IUPAC name is (1E)-N-(3-cyano-5-ethoxycarbonyl-4-methylthiophen-2-yl)ethanimidate.
| Compound Name | (1E)-N-(3-cyano-5-ethoxycarbonyl-4-methylthiophen-2-yl)ethanimidate |
|---|---|
| PubChem CID | 135468933 |
| Molecular Formula | C11H11N2O3S- |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (1E)-N-(3-cyano-5-ethoxycarbonyl-4-methylthiophen-2-yl)ethanimidate |
| SMILES | CCOC(=O)c1sc(/N=C(\C)[O-])c(C#N)c1C |
| InChI | InChI=1S/C11H12N2O3S/c1-4-16-11(15)9-6(2)8(5-12)10(17-9)13-7(3)14/h4H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | HOXMUFDZGGNNEA-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 85.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|