C12H19CuN5S+2 — CID 135469005
copper [azepan-1-yl(sulfoniumylidene)methyl]-[1-(1H-imidazol-2-yl)ethylideneamino]azanide (PubChem CID 135469005) has the molecular formula C12H19CuN5S+2 and a molecular weight of 328.93 g/mol. Its IUPAC name is copper [azepan-1-yl(sulfoniumylidene)methyl]-[1-(1H-imidazol-2-yl)ethylideneamino]azanide.
| Compound Name | copper [azepan-1-yl(sulfoniumylidene)methyl]-[1-(1H-imidazol-2-yl)ethylideneamino]azanide |
|---|---|
| PubChem CID | 135469005 |
| Molecular Formula | C12H19CuN5S+2 |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | copper [azepan-1-yl(sulfoniumylidene)methyl]-[1-(1H-imidazol-2-yl)ethylideneamino]azanide |
| SMILES | [Cu+2].[H]/[S+]=C(/[N-]N=C(C)c1ncc[nH]1)N1CCCCCC1 |
| InChI | InChI=1S/C12H19N5S.Cu/c1-10(11-13-6-7-14-11)15-16-12(18)17-8-4-2-3-5-9-17;/h6-7H,2-5,8-9H2,1H3,(H2,13,14,15,16,18);/q;+2 |
| InChIKey | FEXLFMRMHPNIAO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|