C18H14FN3O3 — CID 135472162
3-(4-fluorophenyl)-7,8-dimethoxy-5H-pyridazino[4,5-b]indol-4-one (PubChem CID 135472162) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7,8-dimethoxy-5H-pyridazino[4,5-b]indol-4-one.
| Compound Name | 3-(4-fluorophenyl)-7,8-dimethoxy-5H-pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 135472162 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-(4-fluorophenyl)-7,8-dimethoxy-5H-pyridazino[4,5-b]indol-4-one |
| SMILES | COc1cc2[nH]c3c(=O)n(-c4ccc(F)cc4)ncc3c2cc1OC |
| InChI | InChI=1S/C18H14FN3O3/c1-24-15-7-12-13-9-20-22(11-5-3-10(19)4-6-11)18(23)17(13)21-14(12)8-16(15)25-2/h3-9,21H,1-2H3 |
| InChIKey | MDXGRVLZFNCXGU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |