C23H17KN2O5 — CID 135474695
potassium ethyl (Z)-3-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)-2-(indol-1-ide-2-carbonyl)prop-2-enoate (PubChem CID 135474695) has the molecular formula C23H17KN2O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is potassium ethyl (Z)-3-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)-2-(indol-1-ide-2-carbonyl)prop-2-enoate.
| Compound Name | potassium ethyl (Z)-3-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)-2-(indol-1-ide-2-carbonyl)prop-2-enoate |
|---|---|
| PubChem CID | 135474695 |
| Molecular Formula | C23H17KN2O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | potassium ethyl (Z)-3-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)-2-(indol-1-ide-2-carbonyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1nc(-c2ccccc2)oc1O)C(=O)c1cc2ccccc2[n-]1.[K+] |
| InChI | InChI=1S/C23H18N2O5.K/c1-2-29-22(27)16(20(26)18-12-15-10-6-7-11-17(15)24-18)13-19-23(28)30-21(25-19)14-8-4-3-5-9-14;/h3-13H,2H2,1H3,(H2,24,26,27,28);/q;+1/p-1 |
| InChIKey | ZQKVPVDAYKJTOM-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|