C14H16N2O7 — CID 135475559
4-[[(Z)-3-hydroxy-1,4,4-trimethoxy-1-oxobut-2-en-2-yl]diazenyl]benzoic acid (PubChem CID 135475559) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is 4-[[(Z)-3-hydroxy-1,4,4-trimethoxy-1-oxobut-2-en-2-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[(Z)-3-hydroxy-1,4,4-trimethoxy-1-oxobut-2-en-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135475559 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-[[(Z)-3-hydroxy-1,4,4-trimethoxy-1-oxobut-2-en-2-yl]diazenyl]benzoic acid |
| SMILES | COC(=O)C(/N=N/c1ccc(C(=O)O)cc1)=C(/O)C(OC)OC |
| InChI | InChI=1S/C14H16N2O7/c1-21-13(20)10(11(17)14(22-2)23-3)16-15-9-6-4-8(5-7-9)12(18)19/h4-7,14,17H,1-3H3,(H,18,19)/b11-10-,16-15+ |
| InChIKey | ZADNBCZOHLRWPB-JXNPCESCSA-N |
| XLogP | 2.03 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|