C19H24N4O4 — CID 135475766
N-[(E)-1-[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]pentanamide (PubChem CID 135475766) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[(E)-1-[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]pentanamide.
| Compound Name | N-[(E)-1-[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]pentanamide |
|---|---|
| PubChem CID | 135475766 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(E)-1-[6-hydroxy-1-(2-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C(\CC)c1c(O)n(-c2ccccc2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24N4O4/c1-4-6-11-15(24)22-21-13(5-2)16-17(25)20-19(27)23(18(16)26)14-10-8-7-9-12(14)3/h7-10,26H,4-6,11H2,1-3H3,(H,22,24)(H,20,25,27)/b21-13+ |
| InChIKey | HNQMKGFEAVRVJV-FYJGNVAPSA-N |
| XLogP | 1.96 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|