C6H5N3O — CID 135476780
6H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 135476780) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is 6H-imidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 6H-imidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 135476780 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 6H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | O=c1[nH]ccc2nccn12 |
| InChI | InChI=1S/C6H5N3O/c10-6-8-2-1-5-7-3-4-9(5)6/h1-4H,(H,8,10) |
| InChIKey | GICKXGZWALFYHZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |