C5H4N4O — CID 135970847
3H-imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 135970847) has the molecular formula C5H4N4O and a molecular weight of 136.11 g/mol. Its IUPAC name is 3H-imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 3H-imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 135970847 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3H-imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | O=c1[nH]cnc2nccn12 |
| InChI | InChI=1S/C5H4N4O/c10-5-8-3-7-4-6-1-2-9(4)5/h1-3H,(H,6,7,8,10) |
| InChIKey | VSGVGDSJPKKZPF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |