C12H13N3O2S2 — CID 135479916
2-[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]-5-methoxyphenol (PubChem CID 135479916) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]-5-methoxyphenol.
| Compound Name | 2-[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 135479916 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2nc(SC)nc(SC)n2)c(O)c1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-17-7-4-5-8(9(16)6-7)10-13-11(18-2)15-12(14-10)19-3/h4-6,16H,1-3H3 |
| InChIKey | XIVXGSSKCWYLBQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |