C12H21N5O5 — CID 135482014
4-(2,2-diethoxyethylamino)-2-(dimethylamino)-5-nitro-1H-pyrimidin-6-one (PubChem CID 135482014) has the molecular formula C12H21N5O5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-(2,2-diethoxyethylamino)-2-(dimethylamino)-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-diethoxyethylamino)-2-(dimethylamino)-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135482014 |
| Molecular Formula | C12H21N5O5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-(2,2-diethoxyethylamino)-2-(dimethylamino)-5-nitro-1H-pyrimidin-6-one |
| SMILES | CCOC(CNc1nc(N(C)C)[nH]c(=O)c1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C12H21N5O5/c1-5-21-8(22-6-2)7-13-10-9(17(19)20)11(18)15-12(14-10)16(3)4/h8H,5-7H2,1-4H3,(H2,13,14,15,18) |
| InChIKey | UHYHQMNROZWAKW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|