C25H17ClN4O3 — CID 135482627
3-[(E)-N-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)amino]-C-methylcarbonimidoyl]-4-hydroxy-1-phenylquinolin-2-one (PubChem CID 135482627) has the molecular formula C25H17ClN4O3 and a molecular weight of 456.89 g/mol. Its IUPAC name is 3-[(E)-N-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)amino]-C-methylcarbonimidoyl]-4-hydroxy-1-phenylquinolin-2-one.
| Compound Name | 3-[(E)-N-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)amino]-C-methylcarbonimidoyl]-4-hydroxy-1-phenylquinolin-2-one |
|---|---|
| PubChem CID | 135482627 |
| Molecular Formula | C25H17ClN4O3 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 3-[(E)-N-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)amino]-C-methylcarbonimidoyl]-4-hydroxy-1-phenylquinolin-2-one |
| SMILES | C/C(=N\N=C1/C(=O)Nc2cc(Cl)ccc21)c1c(O)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C25H17ClN4O3/c1-14(28-29-22-17-12-11-15(26)13-19(17)27-24(22)32)21-23(31)18-9-5-6-10-20(18)30(25(21)33)16-7-3-2-4-8-16/h2-13,31H,1H3,(H,27,29,32)/b28-14+ |
| InChIKey | MFXRPTJYGAFHJO-CCVNUDIWSA-N |
| XLogP | 4.52 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|