C12H12ClNO2 — CID 135482711
(Z)-3-[(4-chlorophenyl)iminomethyl]-4-hydroxypent-3-en-2-one (PubChem CID 135482711) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (Z)-3-[(4-chlorophenyl)iminomethyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-3-[(4-chlorophenyl)iminomethyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 135482711 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (Z)-3-[(4-chlorophenyl)iminomethyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(/C=N/c1ccc(Cl)cc1)=C(/C)O |
| InChI | InChI=1S/C12H12ClNO2/c1-8(15)12(9(2)16)7-14-11-5-3-10(13)4-6-11/h3-7,15H,1-2H3/b12-8-,14-7+ |
| InChIKey | XDXCCCJFVAOODO-GLKCHUTISA-N |
| XLogP | 3.46 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|