C25H21ClN2O3 — CID 177427831
(E)-3-[[2-[[(5-chloro-2-hydroxyphenyl)-phenylmethylidene]amino]phenyl]iminomethyl]-4-hydroxypent-3-en-2-one (PubChem CID 177427831) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is (E)-3-[[2-[[(5-chloro-2-hydroxyphenyl)-phenylmethylidene]amino]phenyl]iminomethyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (E)-3-[[2-[[(5-chloro-2-hydroxyphenyl)-phenylmethylidene]amino]phenyl]iminomethyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 177427831 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (E)-3-[[2-[[(5-chloro-2-hydroxyphenyl)-phenylmethylidene]amino]phenyl]iminomethyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(/C=N/c1ccccc1/N=C(\c1ccccc1)c1cc(Cl)ccc1O)=C(\C)O |
| InChI | InChI=1S/C25H21ClN2O3/c1-16(29)21(17(2)30)15-27-22-10-6-7-11-23(22)28-25(18-8-4-3-5-9-18)20-14-19(26)12-13-24(20)31/h3-15,29,31H,1-2H3/b21-16+,27-15+,28-25+ |
| InChIKey | JBGQCDXAUCBHPN-UEGORJJTSA-N |
| XLogP | 6.34 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|