C6H12N4OS — CID 135484991
[(Z)-[(2Z)-2-hydroxyiminopentan-3-ylidene]amino]thiourea (PubChem CID 135484991) has the molecular formula C6H12N4OS and a molecular weight of 188.26 g/mol. Its IUPAC name is [(Z)-[(2Z)-2-hydroxyiminopentan-3-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(2Z)-2-hydroxyiminopentan-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 135484991 |
| Molecular Formula | C6H12N4OS |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [(Z)-[(2Z)-2-hydroxyiminopentan-3-ylidene]amino]thiourea |
| SMILES | CCC(=N/NC(N)=S)/C(C)=N\O |
| InChI | InChI=1S/C6H12N4OS/c1-3-5(4(2)10-11)8-9-6(7)12/h11H,3H2,1-2H3,(H3,7,9,12)/b8-5-,10-4- |
| InChIKey | NBERQTINSJRNGR-BCFGLSERSA-N |
| XLogP | 0.44 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|