C19H40N8S2 — CID 6811950
1-[2-(diethylamino)ethyl]-3-[2-[2-(diethylamino)ethylcarbamothioylhydrazinylidene]pentan-3-ylideneamino]thiourea (PubChem CID 6811950) has the molecular formula C19H40N8S2 and a molecular weight of 444.72 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[2-[2-(diethylamino)ethylcarbamothioylhydrazinylidene]pentan-3-ylideneamino]thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[2-[2-(diethylamino)ethylcarbamothioylhydrazinylidene]pentan-3-ylideneamino]thiourea |
|---|---|
| PubChem CID | 6811950 |
| Molecular Formula | C19H40N8S2 |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[2-[2-(diethylamino)ethylcarbamothioylhydrazinylidene]pentan-3-ylideneamino]thiourea |
| SMILES | CCC(=NNC(=S)NCCN(CC)CC)C(C)=NNC(=S)NCCN(CC)CC |
| InChI | InChI=1S/C19H40N8S2/c1-7-17(23-25-19(29)21-13-15-27(10-4)11-5)16(6)22-24-18(28)20-12-14-26(8-2)9-3/h7-15H2,1-6H3,(H2,20,24,28)(H2,21,25,29) |
| InChIKey | WFKLZFWBSWQBAH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|