C21H45N7S3 — CID 102234614
1-[2-[bis[2-(tert-butylcarbamothioylamino)ethyl]amino]ethyl]-3-tert-butylthiourea (PubChem CID 102234614) has the molecular formula C21H45N7S3 and a molecular weight of 491.84 g/mol. Its IUPAC name is 1-[2-[bis[2-(tert-butylcarbamothioylamino)ethyl]amino]ethyl]-3-tert-butylthiourea.
| Compound Name | 1-[2-[bis[2-(tert-butylcarbamothioylamino)ethyl]amino]ethyl]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 102234614 |
| Molecular Formula | C21H45N7S3 |
| Molecular Weight | 491.84 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-[2-[bis[2-(tert-butylcarbamothioylamino)ethyl]amino]ethyl]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)NCCN(CCNC(=S)NC(C)(C)C)CCNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C21H45N7S3/c1-19(2,3)25-16(29)22-10-13-28(14-11-23-17(30)26-20(4,5)6)15-12-24-18(31)27-21(7,8)9/h10-15H2,1-9H3,(H2,22,25,29)(H2,23,26,30)(H2,24,27,31) |
| InChIKey | DGWWTGZFDKGBDD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|