C13H26N4S3 — CID 59429219
N-[2-[bis[2-(ethanethioylamino)ethyl]amino]ethyl]propanethioamide (PubChem CID 59429219) has the molecular formula C13H26N4S3 and a molecular weight of 334.58 g/mol. Its IUPAC name is N-[2-[bis[2-(ethanethioylamino)ethyl]amino]ethyl]propanethioamide.
| Compound Name | N-[2-[bis[2-(ethanethioylamino)ethyl]amino]ethyl]propanethioamide |
|---|---|
| PubChem CID | 59429219 |
| Molecular Formula | C13H26N4S3 |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[2-[bis[2-(ethanethioylamino)ethyl]amino]ethyl]propanethioamide |
| SMILES | CCC(=S)NCCN(CCNC(C)=S)CCNC(C)=S |
| InChI | InChI=1S/C13H26N4S3/c1-4-13(20)16-7-10-17(8-5-14-11(2)18)9-6-15-12(3)19/h4-10H2,1-3H3,(H,14,18)(H,15,19)(H,16,20) |
| InChIKey | KHMBJTKNQWDBHU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|