About CID 59088415
CID 59088415 (PubChem CID 59088415) has the molecular formula C3H6BNS
and a molecular weight of 99.97 g/mol.
Molecular Properties
| Compound Name | CID 59088415 |
| PubChem CID | 59088415 |
| Molecular Formula | C3H6BNS |
| Molecular Weight | 99.97 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | — |
| SMILES | [2H]N([B])C(=S)CC |
| InChI | InChI=1S/C3H6BNS/c1-2-3(6)5-4/h2H2,1H3,(H,5,6)/i/hD |
| InChIKey | HHVBHTMEVDFJTJ-DYCDLGHISA-N |
| XLogP | 0.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.97 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 59088415 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59088415?
The IUPAC name of CID 59088415 (CID 59088415) is not available.
What is the SMILES notation for CID 59088415?
The canonical SMILES for CID 59088415 is [2H]N([B])C(=S)CC.
What is the InChIKey of CID 59088415?
The InChIKey is HHVBHTMEVDFJTJ-DYCDLGHISA-N. The full InChI is InChI=1S/C3H6BNS/c1-2-3(6)5-4/h2H2,1H3,(H,5,6)/i/hD.
What are the key properties of CID 59088415?
CID 59088415 has a molecular weight of 99.97 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59088415 is sourced from PubChem (CID 59088415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).