C18H24N6O2S2 — CID 162741296
1-(furan-2-ylmethyl)-3-[(Z)-[(2E)-2-(2H-pyran-6-ylmethylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea (PubChem CID 162741296) has the molecular formula C18H24N6O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(Z)-[(2E)-2-(2H-pyran-6-ylmethylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(Z)-[(2E)-2-(2H-pyran-6-ylmethylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 162741296 |
| Molecular Formula | C18H24N6O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(Z)-[(2E)-2-(2H-pyran-6-ylmethylcarbamothioylhydrazinylidene)pentan-3-ylidene]amino]thiourea |
| SMILES | CCC(=N/NC(=S)NCc1ccco1)/C(C)=N/NC(=S)NCC1=CC=CCO1 |
| InChI | InChI=1S/C18H24N6O2S2/c1-3-16(22-24-18(28)20-12-15-8-6-10-26-15)13(2)21-23-17(27)19-11-14-7-4-5-9-25-14/h4-8,10H,3,9,11-12H2,1-2H3,(H2,19,23,27)(H2,20,24,28)/b21-13+,22-16- |
| InChIKey | IVYDSABKUFNCEY-LEUCPGGXSA-N |
| XLogP | 2.32 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|