C21H30N6O6S — CID 135485646
diethyl (2S)-2-[[5-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioate (PubChem CID 135485646) has the molecular formula C21H30N6O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is diethyl (2S)-2-[[5-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[5-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 135485646 |
| Molecular Formula | C21H30N6O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | diethyl (2S)-2-[[5-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCCCc2c(N)nc(N)[nH]c2=O)s1)C(=O)OCC |
| InChI | InChI=1S/C21H30N6O6S/c1-3-32-16(28)10-7-13(20(31)33-4-2)25-19(30)14-8-9-15(34-14)24-11-5-6-12-17(22)26-21(23)27-18(12)29/h8-9,13,24H,3-7,10-11H2,1-2H3,(H,25,30)(H5,22,23,26,27,29)/t13-/m0/s1 |
| InChIKey | XMHRROMDFHWHOD-ZDUSSCGKSA-N |
| XLogP | 1.05 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|