C18H27NO5S2 — CID 10716065
diethyl (2S)-2-[[3-methyl-5-(3-sulfanylpropyl)thiophene-2-carbonyl]amino]pentanedioate (PubChem CID 10716065) has the molecular formula C18H27NO5S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is diethyl (2S)-2-[[3-methyl-5-(3-sulfanylpropyl)thiophene-2-carbonyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[3-methyl-5-(3-sulfanylpropyl)thiophene-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10716065 |
| Molecular Formula | C18H27NO5S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | diethyl (2S)-2-[[3-methyl-5-(3-sulfanylpropyl)thiophene-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1sc(CCCS)cc1C)C(=O)OCC |
| InChI | InChI=1S/C18H27NO5S2/c1-4-23-15(20)9-8-14(18(22)24-5-2)19-17(21)16-12(3)11-13(26-16)7-6-10-25/h11,14,25H,4-10H2,1-3H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | BPBQWOBVPGXEJT-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|