C22H17N5O — CID 135486211
1-[[4-(imidazol-1-ylmethyl)phenyl]iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one (PubChem CID 135486211) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[[4-(imidazol-1-ylmethyl)phenyl]iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one.
| Compound Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one |
|---|---|
| PubChem CID | 135486211 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one |
| SMILES | O=c1[nH]c2ccc3[nH]cccc3c2c1/C=N/c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C22H17N5O/c28-22-18(21-17-2-1-9-24-19(17)7-8-20(21)26-22)12-25-16-5-3-15(4-6-16)13-27-11-10-23-14-27/h1-12,14,24H,13H2,(H,26,28)/b25-12+ |
| InChIKey | LUOBSXZIDUAZEY-BRJLIKDPSA-N |
| XLogP | 4.00 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|