C22H20N4O2 — CID 135409559
1-[(4-morpholin-4-ylphenyl)iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one (PubChem CID 135409559) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[(4-morpholin-4-ylphenyl)iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one.
| Compound Name | 1-[(4-morpholin-4-ylphenyl)iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one |
|---|---|
| PubChem CID | 135409559 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[(4-morpholin-4-ylphenyl)iminomethyl]-3,6-dihydropyrrolo[3,2-f]quinolin-2-one |
| SMILES | O=c1[nH]c2ccc3[nH]cccc3c2c1/C=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H20N4O2/c27-22-18(21-17-2-1-9-23-19(17)7-8-20(21)25-22)14-24-15-3-5-16(6-4-15)26-10-12-28-13-11-26/h1-9,14,23H,10-13H2,(H,25,27)/b24-14+ |
| InChIKey | OYKRZZOHUSVVRX-ZVHZXABRSA-N |
| XLogP | 3.60 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|