C23H26N4O3+2 — CID 135486559
7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-2-one (PubChem CID 135486559) has the molecular formula C23H26N4O3+2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-2-one.
| Compound Name | 7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 135486559 |
| Molecular Formula | C23H26N4O3+2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-2-one |
| SMILES | Cn1c(-c2cc3ccc(O)c(C[NH+]4CC[NH+](C)CC4)c3oc2=O)nc2ccccc21 |
| InChI | InChI=1S/C23H24N4O3/c1-25-9-11-27(12-10-25)14-17-20(28)8-7-15-13-16(23(29)30-21(15)17)22-24-18-5-3-4-6-19(18)26(22)2/h3-8,13,28H,9-12,14H2,1-2H3/p+2 |
| InChIKey | QRUVRCUIYMEFSZ-UHFFFAOYSA-P |
| XLogP | -0.03 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|