C15H11FN2O2S — CID 135487321
4-[4-(4-fluorophenyl)sulfanyl-1H-pyrazol-5-yl]benzene-1,3-diol (PubChem CID 135487321) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)sulfanyl-1H-pyrazol-5-yl]benzene-1,3-diol.
| Compound Name | 4-[4-(4-fluorophenyl)sulfanyl-1H-pyrazol-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135487321 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-[4-(4-fluorophenyl)sulfanyl-1H-pyrazol-5-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2[nH]ncc2Sc2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-9-1-4-11(5-2-9)21-14-8-17-18-15(14)12-6-3-10(19)7-13(12)20/h1-8,19-20H,(H,17,18) |
| InChIKey | CYIXALHWLQXGPS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |