C21H15Cl2NO3 — CID 135489190
benzyl (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate (PubChem CID 135489190) has the molecular formula C21H15Cl2NO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is benzyl (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate.
| Compound Name | benzyl (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 135489190 |
| Molecular Formula | C21H15Cl2NO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | benzyl (Z)-3-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate |
| SMILES | O=C(OCc1ccccc1)/C(=C(\O)c1ccc(Cl)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C21H15Cl2NO3/c22-15-9-10-16(17(23)12-15)20(25)19(18-8-4-5-11-24-18)21(26)27-13-14-6-2-1-3-7-14/h1-12,25H,13H2/b20-19- |
| InChIKey | SBZHUOPMQZMHSS-VXPUYCOJSA-N |
| XLogP | 5.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|