C36H41N3O3 — CID 135489253
(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2-[(6-phenylmethoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 135489253) has the molecular formula C36H41N3O3 and a molecular weight of 563.74 g/mol. Its IUPAC name is (2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2-[(6-phenylmethoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | (2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2-[(6-phenylmethoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 135489253 |
| Molecular Formula | C36H41N3O3 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | (2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2-[(6-phenylmethoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1CC1=NCCc2c1[nH]c1ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C36H41N3O3/c1-4-24-21-39-15-13-25-18-34(40-2)35(41-3)20-29(25)33(39)17-26(24)16-32-36-28(12-14-37-32)30-19-27(10-11-31(30)38-36)42-22-23-8-6-5-7-9-23/h5-11,18-20,24,26,33,38H,4,12-17,21-22H2,1-3H3/t24-,26-,33-/m0/s1 |
| InChIKey | GSNIRLNWFYLXHY-CWAYLNQUSA-N |
| XLogP | 7.14 |
| TPSA | 59.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|